EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H16N2O6 |
| Net Charge | 0 |
| Average Mass | 296.279 |
| Monoisotopic Mass | 296.10084 |
| SMILES | N[C@@H](CC(=O)O)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C13H16N2O6/c14-9(6-11(17)18)12(19)15-10(13(20)21)5-7-1-3-8(16)4-2-7/h1-4,9-10,16H,5-6,14H2,(H,15,19)(H,17,18)(H,20,21)/t9-,10-/m0/s1 |
| InChIKey | NALWOULWGHTVDA-UWVGGRQHSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Asp-Tyr (CHEBI:73455) has functional parent L-aspartic acid (CHEBI:17053) |
| Asp-Tyr (CHEBI:73455) has functional parent L-tyrosine (CHEBI:17895) |
| Asp-Tyr (CHEBI:73455) has role metabolite (CHEBI:25212) |
| Asp-Tyr (CHEBI:73455) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| L-α-aspartyl-L-tyrosine |
| Synonyms | Source |
|---|---|
| L-Asp-L-Tyr | ChEBI |
| D-Y | ChEBI |
| DY | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0028765 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3106026 | Reaxys |
| CAS:22840-03-5 | ChemIDplus |