EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H12N2O6 |
| Net Charge | 0 |
| Average Mass | 220.181 |
| Monoisotopic Mass | 220.06954 |
| SMILES | N[C@@H](CC(=O)O)C(=O)N[C@@H](CO)C(=O)O |
| InChI | InChI=1S/C7H12N2O6/c8-3(1-5(11)12)6(13)9-4(2-10)7(14)15/h3-4,10H,1-2,8H2,(H,9,13)(H,11,12)(H,14,15)/t3-,4-/m0/s1 |
| InChIKey | DWBZEJHQQIURML-IMJSIDKUSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Asp-Ser (CHEBI:73454) has functional parent L-aspartic acid (CHEBI:17053) |
| Asp-Ser (CHEBI:73454) has functional parent L-serine (CHEBI:17115) |
| Asp-Ser (CHEBI:73454) has role metabolite (CHEBI:25212) |
| Asp-Ser (CHEBI:73454) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| L-α-aspartyl-L-serine |
| Synonyms | Source |
|---|---|
| DS | ChEBI |
| D-S | ChEBI |
| L-Asp-L-Ser | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0028762 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1978604 | Reaxys |