EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H20N4O8 |
| Net Charge | 0 |
| Average Mass | 348.312 |
| Monoisotopic Mass | 348.12811 |
| SMILES | NC(=O)CC[C@H](NC(=O)[C@@H](N)CC(=O)O)C(=O)N[C@@H](CO)C(=O)O |
| InChI | InChI=1S/C12H20N4O8/c13-5(3-9(19)20)10(21)15-6(1-2-8(14)18)11(22)16-7(4-17)12(23)24/h5-7,17H,1-4,13H2,(H2,14,18)(H,15,21)(H,16,22)(H,19,20)(H,23,24)/t5-,6-,7-/m0/s1 |
| InChIKey | DXQOQMCLWWADMU-ACZMJKKPSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Asp-Gln-Ser (CHEBI:73448) has functional parent L-aspartic acid (CHEBI:17053) |
| Asp-Gln-Ser (CHEBI:73448) has functional parent L-glutamine (CHEBI:18050) |
| Asp-Gln-Ser (CHEBI:73448) has functional parent L-serine (CHEBI:17115) |
| Asp-Gln-Ser (CHEBI:73448) has role metabolite (CHEBI:25212) |
| Asp-Gln-Ser (CHEBI:73448) is a tripeptide (CHEBI:47923) |
| IUPAC Name |
|---|
| L-α-aspartyl-L-glutaminyl-L-serine |
| Synonyms | Source |
|---|---|
| L-Asp-L-Gln-L-Ser | ChEBI |
| D-Q-S | ChEBI |
| DQS | ChEBI |