EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H27N7O7 |
| Net Charge | 0 |
| Average Mass | 417.423 |
| Monoisotopic Mass | 417.19720 |
| SMILES | N=C(N)NCCC[C@H](NC(=O)[C@H](CCC(N)=O)NC(=O)[C@@H](N)CC(=O)O)C(=O)O |
| InChI | InChI=1S/C15H27N7O7/c16-7(6-11(24)25)12(26)21-8(3-4-10(17)23)13(27)22-9(14(28)29)2-1-5-20-15(18)19/h7-9H,1-6,16H2,(H2,17,23)(H,21,26)(H,22,27)(H,24,25)(H,28,29)(H4,18,19,20)/t7-,8-,9-/m0/s1 |
| InChIKey | RSMIHCFQDCVVBR-CIUDSAMLSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Asp-Gln-Arg (CHEBI:73447) has functional parent L-arginine (CHEBI:16467) |
| Asp-Gln-Arg (CHEBI:73447) has functional parent L-aspartic acid (CHEBI:17053) |
| Asp-Gln-Arg (CHEBI:73447) has functional parent L-glutamine (CHEBI:18050) |
| Asp-Gln-Arg (CHEBI:73447) has role metabolite (CHEBI:25212) |
| Asp-Gln-Arg (CHEBI:73447) is a tripeptide (CHEBI:47923) |
| IUPAC Name |
|---|
| L-α-aspartyl-L-glutaminyl-L-arginine |
| Synonyms | Source |
|---|---|
| D-Q-R | ChEBI |
| DQR | ChEBI |
| L-Asp-L-Gln-L-Arg | ChEBI |