EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H12N2O7 |
| Net Charge | 0 |
| Average Mass | 248.191 |
| Monoisotopic Mass | 248.06445 |
| SMILES | N[C@@H](CC(=O)O)C(=O)N[C@@H](CC(=O)O)C(=O)O |
| InChI | InChI=1S/C8H12N2O7/c9-3(1-5(11)12)7(15)10-4(8(16)17)2-6(13)14/h3-4H,1-2,9H2,(H,10,15)(H,11,12)(H,13,14)(H,16,17)/t3-,4-/m0/s1 |
| InChIKey | FRYULLIZUDQONW-IMJSIDKUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mycoplasma genitalium (ncbitaxon:2097) | - | PubMed (22817898) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | Mycoplasma genitalium metabolite Any bacterial metabolite produced during a metabolic reaction in Mycoplasma genitalium. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Asp-Asp (CHEBI:73446) has functional parent L-aspartic acid (CHEBI:17053) |
| Asp-Asp (CHEBI:73446) has role Mycoplasma genitalium metabolite (CHEBI:131604) |
| Asp-Asp (CHEBI:73446) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| L-α-aspartyl-L-aspartic acid |
| Synonyms | Source |
|---|---|
| D-D | ChEBI |
| DD | ChEBI |
| L-Asp-L-Asp | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0028749 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1729337 | Reaxys |