EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H36N6O7 |
| Net Charge | 0 |
| Average Mass | 604.664 |
| Monoisotopic Mass | 604.26455 |
| SMILES | CC(C)[C@H](NC(=O)[C@H](Cc1cnc2ccccc12)NC(=O)[C@H](Cc1cnc2ccccc12)NC(=O)[C@@H](N)CC(=O)O)C(=O)O |
| InChI | InChI=1S/C31H36N6O7/c1-16(2)27(31(43)44)37-30(42)25(12-18-15-34-23-10-6-4-8-20(18)23)36-29(41)24(35-28(40)21(32)13-26(38)39)11-17-14-33-22-9-5-3-7-19(17)22/h3-10,14-16,21,24-25,27,33-34H,11-13,32H2,1-2H3,(H,35,40)(H,36,41)(H,37,42)(H,38,39)(H,43,44)/t21-,24-,25-,27-/m0/s1 |
| InChIKey | KBWLCLABEAMUIU-DJESZUOASA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Asp-Trp-Trp-Val (CHEBI:73440) has functional parent L-aspartic acid (CHEBI:17053) |
| Asp-Trp-Trp-Val (CHEBI:73440) has functional parent L-tryptophan (CHEBI:16828) |
| Asp-Trp-Trp-Val (CHEBI:73440) has functional parent L-valine (CHEBI:16414) |
| Asp-Trp-Trp-Val (CHEBI:73440) has role metabolite (CHEBI:25212) |
| Asp-Trp-Trp-Val (CHEBI:73440) is a tetrapeptide (CHEBI:48030) |
| IUPAC Name |
|---|
| L-α-aspartyl-L-tryptophyl-L-tryptophyl-L-valine |
| Synonyms | Source |
|---|---|
| D-W-W-V | ChEBI |
| DWWV | ChEBI |
| L-Asp-L-Trp-L-Trp-L-Val | ChEBI |