EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24N4O9 |
| Net Charge | 0 |
| Average Mass | 404.376 |
| Monoisotopic Mass | 404.15433 |
| SMILES | N[C@@H](CC(=O)O)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CO)C(=O)N[C@@H](CO)C(=O)O |
| InChI | InChI=1S/C15H24N4O9/c16-7(4-11(22)23)14(26)19-3-1-2-10(19)13(25)17-8(5-20)12(24)18-9(6-21)15(27)28/h7-10,20-21H,1-6,16H2,(H,17,25)(H,18,24)(H,22,23)(H,27,28)/t7-,8-,9-,10-/m0/s1 |
| InChIKey | FOXXZZGDIAQPQI-XKNYDFJKSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Asp-Pro-Ser-Ser (CHEBI:73439) has functional parent L-aspartic acid (CHEBI:17053) |
| Asp-Pro-Ser-Ser (CHEBI:73439) has functional parent L-proline (CHEBI:17203) |
| Asp-Pro-Ser-Ser (CHEBI:73439) has functional parent L-serine (CHEBI:17115) |
| Asp-Pro-Ser-Ser (CHEBI:73439) has role metabolite (CHEBI:25212) |
| Asp-Pro-Ser-Ser (CHEBI:73439) is a tetrapeptide (CHEBI:48030) |
| IUPAC Name |
|---|
| L-α-aspartyl-L-prolyl-L-seryl-L-serine |
| Synonyms | Source |
|---|---|
| D-P-S-S | ChEBI |
| DPSS | ChEBI |
| L-Asp-L-Pro-L-Ser-L-Ser | ChEBI |