EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H29N5O10 |
| Net Charge | 0 |
| Average Mass | 523.499 |
| Monoisotopic Mass | 523.19144 |
| SMILES | NC(=O)CC[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H](N)CC(=O)O)C(=O)O |
| InChI | InChI=1S/C22H29N5O10/c23-12(9-17(29)30)19(33)26-14(8-11-4-2-1-3-5-11)20(34)27-15(10-18(31)32)21(35)25-13(22(36)37)6-7-16(24)28/h1-5,12-15H,6-10,23H2,(H2,24,28)(H,25,35)(H,26,33)(H,27,34)(H,29,30)(H,31,32)(H,36,37)/t12-,13-,14-,15-/m0/s1 |
| InChIKey | APXVSPGLYXFFSD-AJNGGQMLSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Asp-Phe-Asp-Gln (CHEBI:73437) has functional parent L-aspartic acid (CHEBI:17053) |
| Asp-Phe-Asp-Gln (CHEBI:73437) has functional parent L-glutamine (CHEBI:18050) |
| Asp-Phe-Asp-Gln (CHEBI:73437) has functional parent L-phenylalanine (CHEBI:17295) |
| Asp-Phe-Asp-Gln (CHEBI:73437) has role metabolite (CHEBI:25212) |
| Asp-Phe-Asp-Gln (CHEBI:73437) is a tetrapeptide (CHEBI:48030) |
| IUPAC Name |
|---|
| L-α-aspartyl-L-phenylalanyl-L-α-aspartyl-L-glutamine |
| Synonyms | Source |
|---|---|
| D-F-D-Q | ChEBI |
| DFDQ | ChEBI |
| L-Asp-L-Phe-L-Asp-L-Gln | ChEBI |