EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H32N4O8 |
| Net Charge | 0 |
| Average Mass | 432.474 |
| Monoisotopic Mass | 432.22201 |
| SMILES | CC(C)C[C@H](NC(=O)[C@@H](N)CC(=O)O)C(=O)N[C@H](C(=O)N[C@@H](CO)C(=O)O)C(C)C |
| InChI | InChI=1S/C18H32N4O8/c1-8(2)5-11(20-15(26)10(19)6-13(24)25)16(27)22-14(9(3)4)17(28)21-12(7-23)18(29)30/h8-12,14,23H,5-7,19H2,1-4H3,(H,20,26)(H,21,28)(H,22,27)(H,24,25)(H,29,30)/t10-,11-,12-,14-/m0/s1 |
| InChIKey | CZECQDPEMSVPDH-MNXVOIDGSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Asp-Leu-Val-Ser (CHEBI:73435) has role metabolite (CHEBI:25212) |
| Asp-Leu-Val-Ser (CHEBI:73435) is a tetrapeptide (CHEBI:48030) |
| IUPAC Name |
|---|
| L-α-aspartyl-L-leucyl-L-valyl-L-serine |
| Synonyms | Source |
|---|---|
| DLVS | ChEBI |
| L-Asp-L-Leu-L-Val-L-Ser | ChEBI |
| D-L-V-S | ChEBI |
| aspartylleucylvalylserine | ChEBI |