EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H30N4O9 |
| Net Charge | 0 |
| Average Mass | 434.446 |
| Monoisotopic Mass | 434.20128 |
| SMILES | CC(C)C[C@H](NC(=O)[C@@H](N)CC(=O)O)C(=O)N[C@H](C(=O)N[C@@H](CO)C(=O)O)[C@@H](C)O |
| InChI | InChI=1S/C17H30N4O9/c1-7(2)4-10(19-14(26)9(18)5-12(24)25)15(27)21-13(8(3)23)16(28)20-11(6-22)17(29)30/h7-11,13,22-23H,4-6,18H2,1-3H3,(H,19,26)(H,20,28)(H,21,27)(H,24,25)(H,29,30)/t8-,9+,10+,11+,13+/m1/s1 |
| InChIKey | ZRUBWRCKIVDCFS-XPCJQDJLSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Asp-Leu-Thr-Ser (CHEBI:73434) has functional parent L-aspartic acid (CHEBI:17053) |
| Asp-Leu-Thr-Ser (CHEBI:73434) has functional parent L-leucine (CHEBI:15603) |
| Asp-Leu-Thr-Ser (CHEBI:73434) has functional parent L-serine (CHEBI:17115) |
| Asp-Leu-Thr-Ser (CHEBI:73434) has functional parent L-threonine (CHEBI:16857) |
| Asp-Leu-Thr-Ser (CHEBI:73434) has role metabolite (CHEBI:25212) |
| Asp-Leu-Thr-Ser (CHEBI:73434) is a tetrapeptide (CHEBI:48030) |
| IUPAC Name |
|---|
| L-α-aspartyl-L-leucyl-L-threonyl-L-serine |
| Synonyms | Source |
|---|---|
| D-L-T-S | ChEBI |
| DLTS | ChEBI |
| L-Asp-L-Leu-L-Thr-L-Ser | ChEBI |