EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H30N4O10 |
| Net Charge | 0 |
| Average Mass | 462.456 |
| Monoisotopic Mass | 462.19619 |
| SMILES | CC(C)C[C@H](NC(=O)[C@@H](N)CC(=O)O)C(=O)N[C@H](C(=O)N[C@@H](CC(=O)O)C(=O)O)[C@@H](C)O |
| InChI | InChI=1S/C18H30N4O10/c1-7(2)4-10(20-15(28)9(19)5-12(24)25)16(29)22-14(8(3)23)17(30)21-11(18(31)32)6-13(26)27/h7-11,14,23H,4-6,19H2,1-3H3,(H,20,28)(H,21,30)(H,22,29)(H,24,25)(H,26,27)(H,31,32)/t8-,9+,10+,11+,14+/m1/s1 |
| InChIKey | YQKYLDVPCOGIRB-SEKJGCFDSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Asp-Leu-Thr-Asp (CHEBI:73433) has functional parent L-aspartic acid (CHEBI:17053) |
| Asp-Leu-Thr-Asp (CHEBI:73433) has functional parent L-leucine (CHEBI:15603) |
| Asp-Leu-Thr-Asp (CHEBI:73433) has functional parent L-threonine (CHEBI:16857) |
| Asp-Leu-Thr-Asp (CHEBI:73433) has role metabolite (CHEBI:25212) |
| Asp-Leu-Thr-Asp (CHEBI:73433) is a tetrapeptide (CHEBI:48030) |
| IUPAC Name |
|---|
| L-α-aspartyl-L-leucyl-L-threonyl-L-aspartic acid |
| Synonyms | Source |
|---|---|
| D-L-T-D | ChEBI |
| DLTD | ChEBI |
| L-Asp-L-Leu-L-Thr-L-Asp | ChEBI |