EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H34N4O8 |
| Net Charge | 0 |
| Average Mass | 446.501 |
| Monoisotopic Mass | 446.23766 |
| SMILES | CC(C)C[C@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](N)CC(=O)O)C(=O)N[C@@H](CO)C(=O)O |
| InChI | InChI=1S/C19H34N4O8/c1-9(2)5-12(21-16(27)11(20)7-15(25)26)17(28)22-13(6-10(3)4)18(29)23-14(8-24)19(30)31/h9-14,24H,5-8,20H2,1-4H3,(H,21,27)(H,22,28)(H,23,29)(H,25,26)(H,30,31)/t11-,12-,13-,14-/m0/s1 |
| InChIKey | TZBJAXGYGSIUHQ-XUXIUFHCSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Asp-Leu-Leu-Ser (CHEBI:73430) has functional parent L-aspartic acid (CHEBI:17053) |
| Asp-Leu-Leu-Ser (CHEBI:73430) has functional parent L-leucine (CHEBI:15603) |
| Asp-Leu-Leu-Ser (CHEBI:73430) has functional parent L-serine (CHEBI:17115) |
| Asp-Leu-Leu-Ser (CHEBI:73430) has role metabolite (CHEBI:25212) |
| Asp-Leu-Leu-Ser (CHEBI:73430) is a tetrapeptide (CHEBI:48030) |
| IUPAC Name |
|---|
| L-α-aspartyl-L-leucyl-L-leucyl-L-serine |
| Synonyms | Source |
|---|---|
| D-L-L-S | ChEBI |
| DLLS | ChEBI |
| L-Asp-L-Leu-L-Leu-L-Ser | ChEBI |