EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H37N5O8 |
| Net Charge | 0 |
| Average Mass | 487.554 |
| Monoisotopic Mass | 487.26421 |
| SMILES | CC(C)C[C@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](N)CC(=O)O)C(=O)N[C@@H](CCC(N)=O)C(=O)O |
| InChI | InChI=1S/C21H37N5O8/c1-10(2)7-14(25-18(30)12(22)9-17(28)29)20(32)26-15(8-11(3)4)19(31)24-13(21(33)34)5-6-16(23)27/h10-15H,5-9,22H2,1-4H3,(H2,23,27)(H,24,31)(H,25,30)(H,26,32)(H,28,29)(H,33,34)/t12-,13-,14-,15-/m0/s1 |
| InChIKey | JTRDJYIZIKCIRC-AJNGGQMLSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Asp-Leu-Leu-Gln (CHEBI:73429) has functional parent L-aspartic acid (CHEBI:17053) |
| Asp-Leu-Leu-Gln (CHEBI:73429) has functional parent L-glutamine (CHEBI:18050) |
| Asp-Leu-Leu-Gln (CHEBI:73429) has functional parent L-leucine (CHEBI:15603) |
| Asp-Leu-Leu-Gln (CHEBI:73429) has role metabolite (CHEBI:25212) |
| Asp-Leu-Leu-Gln (CHEBI:73429) is a tetrapeptide (CHEBI:48030) |
| IUPAC Name |
|---|
| L-α-aspartyl-L-leucyl-L-leucyl-L-glutamine |
| Synonyms | Source |
|---|---|
| DLLQ | ChEBI |
| L-Asp-L-Leu-L-Leu-L-Gln | ChEBI |
| D-L-L-Q | ChEBI |