EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H31N5O10 |
| Net Charge | 0 |
| Average Mass | 489.482 |
| Monoisotopic Mass | 489.20709 |
| SMILES | CC(C)C[C@H](NC(=O)[C@@H](N)CC(=O)O)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](CCC(N)=O)C(=O)O |
| InChI | InChI=1S/C19H31N5O10/c1-8(2)5-11(23-16(30)9(20)6-14(26)27)17(31)24-12(7-15(28)29)18(32)22-10(19(33)34)3-4-13(21)25/h8-12H,3-7,20H2,1-2H3,(H2,21,25)(H,22,32)(H,23,30)(H,24,31)(H,26,27)(H,28,29)(H,33,34)/t9-,10-,11-,12-/m0/s1 |
| InChIKey | CMBDUPIBCOEWNE-BJDJZHNGSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Asp-Leu-Asp-Gln (CHEBI:73428) has functional parent L-aspartic acid (CHEBI:17053) |
| Asp-Leu-Asp-Gln (CHEBI:73428) has functional parent L-glutamine (CHEBI:18050) |
| Asp-Leu-Asp-Gln (CHEBI:73428) has functional parent L-leucine (CHEBI:15603) |
| Asp-Leu-Asp-Gln (CHEBI:73428) has role metabolite (CHEBI:25212) |
| Asp-Leu-Asp-Gln (CHEBI:73428) is a tetrapeptide (CHEBI:48030) |
| IUPAC Name |
|---|
| L-α-aspartyl-L-leucyl-L-α-aspartyl-L-glutamine |
| Synonyms | Source |
|---|---|
| D-L-D-Q | ChEBI |
| DLDQ | ChEBI |
| L-Asp-L-Leu-L-Asp-L-Gln | ChEBI |