EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H17N3O5 |
| Net Charge | 0 |
| Average Mass | 295.295 |
| Monoisotopic Mass | 295.11682 |
| SMILES | NC(=O)C[C@H](N)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C13H17N3O5/c14-9(6-11(15)18)12(19)16-10(13(20)21)5-7-1-3-8(17)4-2-7/h1-4,9-10,17H,5-6,14H2,(H2,15,18)(H,16,19)(H,20,21)/t9-,10-/m0/s1 |
| InChIKey | FYRVDDJMNISIKJ-UWVGGRQHSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Asn-Tyr (CHEBI:73427) has functional parent L-asparagine (CHEBI:17196) |
| Asn-Tyr (CHEBI:73427) has functional parent L-tyrosine (CHEBI:17895) |
| Asn-Tyr (CHEBI:73427) has role metabolite (CHEBI:25212) |
| Asn-Tyr (CHEBI:73427) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| L-asparaginyl-L-tyrosine |
| Synonyms | Source |
|---|---|
| NY | ChEBI |
| L-Asn-L-Tyr | ChEBI |
| N-Y | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0028743 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6343016 | Reaxys |