EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H15N3O4 |
| Net Charge | 0 |
| Average Mass | 229.236 |
| Monoisotopic Mass | 229.10626 |
| SMILES | NC(=O)C[C@H](N)C(=O)N1CCC[C@H]1C(=O)O |
| InChI | InChI=1S/C9H15N3O4/c10-5(4-7(11)13)8(14)12-3-1-2-6(12)9(15)16/h5-6H,1-4,10H2,(H2,11,13)(H,15,16)/t5-,6-/m0/s1 |
| InChIKey | GADKFYNESXNRLC-WDSKDSINSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Asn-Pro (CHEBI:73425) has functional parent L-asparagine (CHEBI:17196) |
| Asn-Pro (CHEBI:73425) has functional parent L-proline (CHEBI:17203) |
| Asn-Pro (CHEBI:73425) has role metabolite (CHEBI:25212) |
| Asn-Pro (CHEBI:73425) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| L-asparaginyl-L-proline |
| Synonyms | Source |
|---|---|
| L-Asn-L-Pro | ChEBI |
| NP | ChEBI |
| N-P | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0028739 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21341295 | Reaxys |