EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H16N4O5 |
| Net Charge | 0 |
| Average Mass | 260.250 |
| Monoisotopic Mass | 260.11207 |
| SMILES | NC(=O)CC[C@H](NC(=O)[C@@H](N)CC(N)=O)C(=O)O |
| InChI | InChI=1S/C9H16N4O5/c10-4(3-7(12)15)8(16)13-5(9(17)18)1-2-6(11)14/h4-5H,1-3,10H2,(H2,11,14)(H2,12,15)(H,13,16)(H,17,18)/t4-,5-/m0/s1 |
| InChIKey | QCWJKJLNCFEVPQ-WHFBIAKZSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Asn-Gln (CHEBI:73421) has functional parent L-asparagine (CHEBI:17196) |
| Asn-Gln (CHEBI:73421) has functional parent L-glutamine (CHEBI:18050) |
| Asn-Gln (CHEBI:73421) has role metabolite (CHEBI:25212) |
| Asn-Gln (CHEBI:73421) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| L-asparaginyl-L-glutamine |
| Synonyms | Source |
|---|---|
| N-Q | ChEBI |
| NQ | ChEBI |
| L-Asn-L-Gln | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0028729 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2388358 | Reaxys |