EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H28N6O9 |
| Net Charge | 0 |
| Average Mass | 520.499 |
| Monoisotopic Mass | 520.19178 |
| SMILES | NC(=O)C[C@H](N)C(=O)N[C@@H](Cc1cnc2ccccc12)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](CO)C(=O)O |
| InChI | InChI=1S/C22H28N6O9/c23-12(6-17(24)30)19(33)26-14(5-10-8-25-13-4-2-1-3-11(10)13)20(34)27-15(7-18(31)32)21(35)28-16(9-29)22(36)37/h1-4,8,12,14-16,25,29H,5-7,9,23H2,(H2,24,30)(H,26,33)(H,27,34)(H,28,35)(H,31,32)(H,36,37)/t12-,14-,15-,16-/m0/s1 |
| InChIKey | WSNSZZGIMVHDHF-TUUVXOQKSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Asn-Trp-Asp-Ser (CHEBI:73414) has functional parent L-asparagine (CHEBI:17196) |
| Asn-Trp-Asp-Ser (CHEBI:73414) has functional parent L-aspartic acid (CHEBI:17053) |
| Asn-Trp-Asp-Ser (CHEBI:73414) has functional parent L-serine (CHEBI:17115) |
| Asn-Trp-Asp-Ser (CHEBI:73414) has functional parent L-tryptophan (CHEBI:16828) |
| Asn-Trp-Asp-Ser (CHEBI:73414) has role metabolite (CHEBI:25212) |
| Asn-Trp-Asp-Ser (CHEBI:73414) is a tetrapeptide (CHEBI:48030) |
| IUPAC Name |
|---|
| L-asparaginyl-L-tryptophyl-L-α-aspartyl-L-serine |
| Synonyms | Source |
|---|---|
| NWDS | ChEBI |
| N-W-D-S | ChEBI |
| L-Asn-L-Trp-L-Asp-L-Ser | ChEBI |