EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H21NO2 |
| Net Charge | 0 |
| Average Mass | 271.360 |
| Monoisotopic Mass | 271.15723 |
| SMILES | CNCCC(Oc1ccccc1OC)c1ccccc1 |
| InChI | InChI=1S/C17H21NO2/c1-18-13-12-15(14-8-4-3-5-9-14)20-17-11-7-6-10-16(17)19-2/h3-11,15,18H,12-13H2,1-2H3 |
| InChIKey | ITJNARMNRKSWTA-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | adrenergic uptake inhibitor Adrenergic uptake inhibitors are drugs that block the transport of adrenergic transmitters into axon terminals or into storage vesicles within terminals. The tricyclic antidepressants and amphetamines are among the therapeutically important drugs that may act via inhibition of adrenergic transport. Many of these drugs also block transport of serotonin. |
| Applications: | adrenergic uptake inhibitor Adrenergic uptake inhibitors are drugs that block the transport of adrenergic transmitters into axon terminals or into storage vesicles within terminals. The tricyclic antidepressants and amphetamines are among the therapeutically important drugs that may act via inhibition of adrenergic transport. Many of these drugs also block transport of serotonin. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nisoxetine (CHEBI:73410) has role adrenergic uptake inhibitor (CHEBI:35640) |
| nisoxetine (CHEBI:73410) has role antidepressant (CHEBI:35469) |
| nisoxetine (CHEBI:73410) is a aromatic ether (CHEBI:35618) |
| nisoxetine (CHEBI:73410) is a secondary amino compound (CHEBI:50995) |
| Incoming Relation(s) |
| nisoxetine hydrochloride (CHEBI:232874) has part nisoxetine (CHEBI:73410) |
| IUPAC Name |
|---|
| 3-(2-methoxyphenoxy)-N-methyl-3-phenylpropan-1-amine |
| INNs | Source |
|---|---|
| nisoxetine | KEGG DRUG |
| nisoxétine | WHO MedNet |
| nisoxetinum | WHO MedNet |
| nisoxetina | WHO MedNet |
| Synonyms | Source |
|---|---|
| 3-(2-Methoxyphenoxy)-N-methyl-3-phenylpropylamine | ChemIDplus |
| 3-(o-Methoxyphenoxy)-N-methyl-3-phenylpropylamine | ChemIDplus |
| N-Methyl-gamma-(2-methylphenoxy)phenylpropanolamine | ChemIDplus |
| DL-N-Methyl-3-(o-methoxyphenoxy)-N-methyl-3-phenylpropylamine | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| D05173 | KEGG DRUG |
| Nisoxetine | Wikipedia |
| LSM-1934 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2946689 | Reaxys |
| CAS:53179-07-0 | KEGG DRUG |
| CAS:53179-07-0 | ChemIDplus |
| CAS:57226-61-6 | ChemIDplus |
| Citations |
|---|