EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H29N5O10 |
| Net Charge | 0 |
| Average Mass | 475.455 |
| Monoisotopic Mass | 475.19144 |
| SMILES | CC(C)C[C@H](NC(=O)[C@@H](N)CC(N)=O)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](CC(=O)O)C(=O)O |
| InChI | InChI=1S/C18H29N5O10/c1-7(2)3-9(21-15(29)8(19)4-12(20)24)16(30)22-10(5-13(25)26)17(31)23-11(18(32)33)6-14(27)28/h7-11H,3-6,19H2,1-2H3,(H2,20,24)(H,21,29)(H,22,30)(H,23,31)(H,25,26)(H,27,28)(H,32,33)/t8-,9-,10-,11-/m0/s1 |
| InChIKey | ALKWEXBKAHPJAQ-NAKRPEOUSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Asn-Leu-Asp-Asp (CHEBI:73408) has functional parent L-asparagine (CHEBI:17196) |
| Asn-Leu-Asp-Asp (CHEBI:73408) has functional parent L-aspartic acid (CHEBI:17053) |
| Asn-Leu-Asp-Asp (CHEBI:73408) has functional parent L-leucine (CHEBI:15603) |
| Asn-Leu-Asp-Asp (CHEBI:73408) has role metabolite (CHEBI:25212) |
| Asn-Leu-Asp-Asp (CHEBI:73408) is a tetrapeptide (CHEBI:48030) |
| IUPAC Name |
|---|
| L-asparaginyl-L-leucyl-L-α-aspartyl-L-aspartic acid |
| Synonyms | Source |
|---|---|
| L-Asn-L-Leu-L-Asp-L-Asp | ChEBI |
| N-L-D-D | ChEBI |
| NLDD | ChEBI |