EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H14N4O5 |
| Net Charge | 0 |
| Average Mass | 246.223 |
| Monoisotopic Mass | 246.09642 |
| SMILES | NC(=O)C[C@H](NC(=O)[C@@H](N)CC(N)=O)C(=O)O |
| InChI | InChI=1S/C8H14N4O5/c9-3(1-5(10)13)7(15)12-4(8(16)17)2-6(11)14/h3-4H,1-2,9H2,(H2,10,13)(H2,11,14)(H,12,15)(H,16,17)/t3-,4-/m0/s1 |
| InChIKey | RJUHZPRQRQLCFL-IMJSIDKUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mycoplasma genitalium (ncbitaxon:2097) | - | PubMed (22817898) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | Mycoplasma genitalium metabolite Any bacterial metabolite produced during a metabolic reaction in Mycoplasma genitalium. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Asn-Asn (CHEBI:73406) has functional parent L-asparagine (CHEBI:17196) |
| Asn-Asn (CHEBI:73406) has role Mycoplasma genitalium metabolite (CHEBI:131604) |
| Asn-Asn (CHEBI:73406) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| L-asparaginyl-L-asparagine |
| Synonyms | Source |
|---|---|
| N-N | ChEBI |
| NN | ChEBI |
| L-Asn-L-Asn | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0028726 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:15124881 | Reaxys |