EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H38N8O7 |
| Net Charge | 0 |
| Average Mass | 610.672 |
| Monoisotopic Mass | 610.28635 |
| SMILES | N=C(N)NCCC[C@H](N)C(=O)N[C@@H](Cc1cnc2ccccc12)C(=O)N[C@@H](CO)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C29H38N8O7/c30-20(5-3-11-33-29(31)32)25(40)35-22(13-17-14-34-21-6-2-1-4-19(17)21)26(41)37-24(15-38)27(42)36-23(28(43)44)12-16-7-9-18(39)10-8-16/h1-2,4,6-10,14,20,22-24,34,38-39H,3,5,11-13,15,30H2,(H,35,40)(H,36,42)(H,37,41)(H,43,44)(H4,31,32,33)/t20-,22-,23-,24-/m0/s1 |
| InChIKey | YIPPLTJOZWIWIK-BIHRQFPBSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Arg-Trp-Ser-Tyr (CHEBI:73405) has functional parent L-arginine (CHEBI:16467) |
| Arg-Trp-Ser-Tyr (CHEBI:73405) has functional parent L-serine (CHEBI:17115) |
| Arg-Trp-Ser-Tyr (CHEBI:73405) has functional parent L-tryptophan (CHEBI:16828) |
| Arg-Trp-Ser-Tyr (CHEBI:73405) has functional parent L-tyrosine (CHEBI:17895) |
| Arg-Trp-Ser-Tyr (CHEBI:73405) has role metabolite (CHEBI:25212) |
| Arg-Trp-Ser-Tyr (CHEBI:73405) is a tetrapeptide (CHEBI:48030) |
| IUPAC Name |
|---|
| L-arginyl-L-tryptophyl-L-seryl-L-tyrosine |
| Synonyms | Source |
|---|---|
| R-W-S-Y | ChEBI |
| RWSY | ChEBI |
| L-Arg-L-Trp-L-Ser-L-Tyr | ChEBI |