EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H40N12O7 |
| Net Charge | 0 |
| Average Mass | 572.628 |
| Monoisotopic Mass | 572.31429 |
| SMILES | N=C(N)NCCC[C@H](NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CC(N)=O)NC(=O)[C@@H](N)CCCNC(=N)N)C(=O)O |
| InChI | InChI=1S/C21H40N12O7/c22-10(3-1-7-29-20(25)26)16(36)33-13(9-15(24)35)18(38)31-11(5-6-14(23)34)17(37)32-12(19(39)40)4-2-8-30-21(27)28/h10-13H,1-9,22H2,(H2,23,34)(H2,24,35)(H,31,38)(H,32,37)(H,33,36)(H,39,40)(H4,25,26,29)(H4,27,28,30)/t10-,11-,12-,13-/m0/s1 |
| InChIKey | XUBLMYHWSFRACH-CYDGBPFRSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Arg-Asn-Gln-Arg (CHEBI:73397) has functional parent L-arginine (CHEBI:16467) |
| Arg-Asn-Gln-Arg (CHEBI:73397) has functional parent L-asparagine (CHEBI:17196) |
| Arg-Asn-Gln-Arg (CHEBI:73397) has functional parent L-glutamine (CHEBI:18050) |
| Arg-Asn-Gln-Arg (CHEBI:73397) has role metabolite (CHEBI:25212) |
| Arg-Asn-Gln-Arg (CHEBI:73397) is a tetrapeptide (CHEBI:48030) |
| IUPAC Name |
|---|
| L-arginyl-L-asparaginyl-L-glutaminyl-L-arginine |
| Synonyms | Source |
|---|---|
| R-N-Q-R | ChEBI |
| RNQR | ChEBI |
| L-Arg-L-Asn-L-Gln-L-Arg | ChEBI |