EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H30N4O8 |
| Net Charge | 0 |
| Average Mass | 466.491 |
| Monoisotopic Mass | 466.20636 |
| SMILES | CC(C)[C@H](NC(=O)[C@H](C)N)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C21H30N4O8/c1-10(2)17(25-18(29)11(3)22)20(31)23-14(9-16(27)28)19(30)24-15(21(32)33)8-12-4-6-13(26)7-5-12/h4-7,10-11,14-15,17,26H,8-9,22H2,1-3H3,(H,23,31)(H,24,30)(H,25,29)(H,27,28)(H,32,33)/t11-,14-,15-,17-/m0/s1 |
| InChIKey | OIRCZHKOHJUHAC-SIUGBPQLSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ala-Val-Asp-Tyr (CHEBI:73391) has functional parent L-alanine (CHEBI:16977) |
| Ala-Val-Asp-Tyr (CHEBI:73391) has functional parent L-aspartic acid (CHEBI:17053) |
| Ala-Val-Asp-Tyr (CHEBI:73391) has functional parent L-tyrosine (CHEBI:17895) |
| Ala-Val-Asp-Tyr (CHEBI:73391) has functional parent L-valine (CHEBI:16414) |
| Ala-Val-Asp-Tyr (CHEBI:73391) has role metabolite (CHEBI:25212) |
| Ala-Val-Asp-Tyr (CHEBI:73391) is a tetrapeptide (CHEBI:48030) |
| IUPAC Name |
|---|
| L-alanyl-L-valyl-L-α-aspartyl-L-tyrosine |
| Synonyms | Source |
|---|---|
| AVDY | ChEBI |
| A-V-D-Y | ChEBI |
| L-Ala-L-Val-L-Asp-L-Tyr | ChEBI |