EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H30O2 |
| Net Charge | 0 |
| Average Mass | 326.480 |
| Monoisotopic Mass | 326.22458 |
| SMILES | [H][C@@]12CC[C@](C)(C(=O)CC)[C@@]1(C)CCC1=C3CCC(=O)C=C3CC[C@]12[H] |
| InChI | InChI=1S/C22H30O2/c1-4-20(24)22(3)12-10-19-18-7-5-14-13-15(23)6-8-16(14)17(18)9-11-21(19,22)2/h13,18-19H,4-12H2,1-3H3/t18-,19+,21+,22-/m1/s1 |
| InChIKey | QFFCYTLOTYIJMR-XMGTWHOFSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | progestin A synthetic progestogen. progesterone receptor agonist A hormone agonist that binds to and activates progesterone receptors. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. progesterone receptor agonist A hormone agonist that binds to and activates progesterone receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| promegestone (CHEBI:73390) has parent hydride estrane (CHEBI:23966) |
| promegestone (CHEBI:73390) has role antineoplastic agent (CHEBI:35610) |
| promegestone (CHEBI:73390) has role progesterone receptor agonist (CHEBI:70709) |
| promegestone (CHEBI:73390) has role progestin (CHEBI:59826) |
| promegestone (CHEBI:73390) is a 20-oxo steroid (CHEBI:36885) |
| promegestone (CHEBI:73390) is a 3-oxo-Δ4 steroid (CHEBI:47909) |
| IUPAC Name |
|---|
| (17β)-17-methyl-17-propionylestra-4,9-dien-3-one |
| INNs | Source |
|---|---|
| promegestona | ChemIDplus |
| promegestone | KEGG DRUG |
| promegestonum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 17,21-dimethyl-19-norpregna-4,9(10)-diene-3,20-dione | ChEBI |
| 17α-methyl-17-propionylestra-4,9-dien-3-one | ChemIDplus |
| R 5020 | ChemIDplus |
| RU5020 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 2285 | DrugCentral |
| C14208 | KEGG COMPOUND |
| D08431 | KEGG DRUG |
| Promegestone | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5104746 | Reaxys |
| CAS:34184-77-5 | ChemIDplus |
| CAS:34184-77-5 | KEGG COMPOUND |
| Citations |
|---|