EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H9N3O4 |
| Net Charge | 0 |
| Average Mass | 163.133 |
| Monoisotopic Mass | 163.05931 |
| SMILES | NC(=O)NOC[C@H]([NH3+])C(=O)[O-] |
| InChI | InChI=1S/C4H9N3O4/c5-2(3(8)9)1-11-7-4(6)10/h2H,1,5H2,(H,8,9)(H3,6,7,10)/t2-/m0/s1 |
| InChIKey | ZFLDWYJOQSXISF-REOHCLBHSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| O-ureido-L-serine zwitterion (CHEBI:73389) is a L-α-amino acid zwitterion (CHEBI:59869) |
| O-ureido-L-serine zwitterion (CHEBI:73389) is tautomer of O-ureido-L-serine (CHEBI:73536) |
| Incoming Relation(s) |
| O-ureido-L-serine (CHEBI:73536) is tautomer of O-ureido-L-serine zwitterion (CHEBI:73389) |
| IUPAC Name |
|---|
| (2S)-2-azaniumyl-3-[(carbamoylamino)oxy]propanoate |
| Synonym | Source |
|---|---|
| (2S)-2-ammonio-3-[(carbamoylamino)oxy]propanoate | IUPAC |
| UniProt Name | Source |
|---|---|
| O-ureido-L-serine | UniProt |
| Citations |
|---|