EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C39H66O2S2 |
| Net Charge | 0 |
| Average Mass | 631.089 |
| Monoisotopic Mass | 630.45042 |
| SMILES | CSC1=C(CCC(C)CCCC(C)CCCC(C)CCCC(C)CCCC(C)CCCC(C)C)C(=O)c2sccc2C1=O |
| InChI | InChI=1S/C39H66O2S2/c1-28(2)14-9-15-29(3)16-10-17-30(4)18-11-19-31(5)20-12-21-32(6)22-13-23-33(7)24-25-34-37(41)39-35(26-27-43-39)36(40)38(34)42-8/h26-33H,9-25H2,1-8H3 |
| InChIKey | GHRWXPXOBGRSHG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| caldariellaquinone (CHEBI:73387) has role metabolite (CHEBI:25212) |
| caldariellaquinone (CHEBI:73387) is a p-quinones (CHEBI:25830) |
| caldariellaquinone (CHEBI:73387) is a 1-benzothiophenes (CHEBI:38836) |
| caldariellaquinone (CHEBI:73387) is a organic sulfide (CHEBI:16385) |
| IUPAC Name |
|---|
| 6-(3,7,11,15,19,23-hexamethyltetracosyl)-5-(methylsulfanyl)-1-benzothiophene-4,7-dione |
| Synonym | Source |
|---|---|
| 6-(3,7,11,15,19,23-hexamethyltetracosyl)-5-methylthiobenzo[b]thiophen-4,7-quinone | SUBMITTER |
| UniProt Name | Source |
|---|---|
| caldariellaquinone | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-9612 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| CAS:63693-26-5 | ChemIDplus |
| Citations |
|---|