EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H28N6O8 |
| Net Charge | 0 |
| Average Mass | 504.500 |
| Monoisotopic Mass | 504.19686 |
| SMILES | C[C@H](N)C(=O)N[C@@H](Cc1cnc2ccccc12)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CC(=O)O)C(=O)O |
| InChI | InChI=1S/C22H28N6O8/c1-10(23)19(32)26-14(6-11-9-25-13-5-3-2-4-12(11)13)20(33)27-15(7-17(24)29)21(34)28-16(22(35)36)8-18(30)31/h2-5,9-10,14-16,25H,6-8,23H2,1H3,(H2,24,29)(H,26,32)(H,27,33)(H,28,34)(H,30,31)(H,35,36)/t10-,14-,15-,16-/m0/s1 |
| InChIKey | UTHAHBPIPHFUMP-MVWHLILJSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ala-Trp-Asn-Asp (CHEBI:73382) has functional parent L-alanine (CHEBI:16977) |
| Ala-Trp-Asn-Asp (CHEBI:73382) has functional parent L-asparagine (CHEBI:17196) |
| Ala-Trp-Asn-Asp (CHEBI:73382) has functional parent L-aspartic acid (CHEBI:17053) |
| Ala-Trp-Asn-Asp (CHEBI:73382) has functional parent L-tryptophan (CHEBI:16828) |
| Ala-Trp-Asn-Asp (CHEBI:73382) has role metabolite (CHEBI:25212) |
| Ala-Trp-Asn-Asp (CHEBI:73382) is a tetrapeptide (CHEBI:48030) |
| IUPAC Name |
|---|
| L-alanyl-L-tryptophyl-L-asparaginyl-L-aspartic acid |
| Synonyms | Source |
|---|---|
| A-W-N-D | ChEBI |
| AWND | ChEBI |
| L-Ala-L-Trp-L-Asn-L-Asp | ChEBI |