EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H27N3O4S |
| Net Charge | 0 |
| Average Mass | 393.509 |
| Monoisotopic Mass | 393.17223 |
| SMILES | Cn1cc(C(=O)OCC2CCN(CCNS(C)(=O)=O)CC2)c2ccccc21 |
| InChI | InChI=1S/C19H27N3O4S/c1-21-13-17(16-5-3-4-6-18(16)21)19(23)26-14-15-7-10-22(11-8-15)12-9-20-27(2,24)25/h3-6,13,15,20H,7-12,14H2,1-2H3 |
| InChIKey | MOZPSIXKYJUTKI-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. |
| Application: | serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| GR 113808 (CHEBI:73380) has role serotonergic antagonist (CHEBI:48279) |
| GR 113808 (CHEBI:73380) is a indolyl carboxylate ester (CHEBI:46939) |
| GR 113808 (CHEBI:73380) is a piperidines (CHEBI:26151) |
| GR 113808 (CHEBI:73380) is a sulfonamide (CHEBI:35358) |
| IUPAC Name |
|---|
| (1-{2-[(methylsulfonyl)amino]ethyl}piperidin-4-yl)methyl 1-methyl-1H-indole-3-carboxylate |
| Synonyms | Source |
|---|---|
| GR113808 | ChemIDplus |
| GR-113808 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| EP501322 | Patent |
| GR-113,808 | Wikipedia |
| LSM-3098 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7778599 | Reaxys |
| CAS:144625-51-4 | ChemIDplus |
| Citations |
|---|