EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H32N6O6 |
| Net Charge | 0 |
| Average Mass | 536.589 |
| Monoisotopic Mass | 536.23833 |
| SMILES | C[C@H](N)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1cnc2ccccc12)C(=O)N[C@@H](CC(N)=O)C(=O)O |
| InChI | InChI=1S/C27H32N6O6/c1-15(28)24(35)31-20(11-16-7-3-2-4-8-16)25(36)32-21(26(37)33-22(27(38)39)13-23(29)34)12-17-14-30-19-10-6-5-9-18(17)19/h2-10,14-15,20-22,30H,11-13,28H2,1H3,(H2,29,34)(H,31,35)(H,32,36)(H,33,37)(H,38,39)/t15-,20-,21-,22-/m0/s1 |
| InChIKey | PPSSXNJBIKWOLE-JNHSIYEJSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ala-Phe-Trp-Asn (CHEBI:73379) has functional parent L-alanine (CHEBI:16977) |
| Ala-Phe-Trp-Asn (CHEBI:73379) has functional parent L-asparagine (CHEBI:17196) |
| Ala-Phe-Trp-Asn (CHEBI:73379) has functional parent L-phenylalanine (CHEBI:17295) |
| Ala-Phe-Trp-Asn (CHEBI:73379) has functional parent L-tryptophan (CHEBI:16828) |
| Ala-Phe-Trp-Asn (CHEBI:73379) has role metabolite (CHEBI:25212) |
| Ala-Phe-Trp-Asn (CHEBI:73379) is a tetrapeptide (CHEBI:48030) |
| IUPAC Name |
|---|
| L-alanyl-L-phenylalanyl-L-tryptophyl-L-asparagine |
| Synonyms | Source |
|---|---|
| A-F-W-N | ChEBI |
| AFWN | ChEBI |
| L-Ala-L-Phe-L-Trp-L-Asn | ChEBI |