EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H28N4O7 |
| Net Charge | 0 |
| Average Mass | 424.454 |
| Monoisotopic Mass | 424.19580 |
| SMILES | C[C@H](N)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@H](C(=O)N[C@@H](CO)C(=O)O)[C@@H](C)O |
| InChI | InChI=1S/C19H28N4O7/c1-10(20)16(26)21-13(8-12-6-4-3-5-7-12)17(27)23-15(11(2)25)18(28)22-14(9-24)19(29)30/h3-7,10-11,13-15,24-25H,8-9,20H2,1-2H3,(H,21,26)(H,22,28)(H,23,27)(H,29,30)/t10-,11+,13-,14-,15-/m0/s1 |
| InChIKey | CUOMGDPDITUMIJ-HZZBMVKVSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ala-Phe-Thr-Ser (CHEBI:73377) has functional parent L-alanine (CHEBI:16977) |
| Ala-Phe-Thr-Ser (CHEBI:73377) has functional parent L-phenylalanine (CHEBI:17295) |
| Ala-Phe-Thr-Ser (CHEBI:73377) has functional parent L-serine (CHEBI:17115) |
| Ala-Phe-Thr-Ser (CHEBI:73377) has functional parent L-threonine (CHEBI:16857) |
| Ala-Phe-Thr-Ser (CHEBI:73377) has role metabolite (CHEBI:25212) |
| Ala-Phe-Thr-Ser (CHEBI:73377) is a tetrapeptide (CHEBI:48030) |
| IUPAC Name |
|---|
| L-alanyl-L-phenylalanyl-L-threonyl-L-serine |
| Synonyms | Source |
|---|---|
| AFTS | ChEBI |
| L-Ala-L-Phe-L-Thr-L-Ser | ChEBI |
| A-F-T-S | ChEBI |