EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C43H46CoN4O16 |
| Net Charge | 0 |
| Average Mass | 933.786 |
| Monoisotopic Mass | 933.22408 |
| SMILES | CC1=C2[N+]3=C(C=C4[N]5C(=CC6=[N+]7C(=Cc8c(CCC(=O)O)c(CC(=O)O)c1[n]8[Co-2]573)C(CCC(=O)O)=C6CC(=O)O)[C@@H](CCC(=O)O)[C@]4(C)CC(=O)O)[C@@H](CCC(=O)O)[C@]2(C)CC(=O)O |
| InChI | InChI=1S/C43H48N4O16.Co/c1-19-40-23(13-37(58)59)21(5-9-33(50)51)27(46-40)14-26-20(4-8-32(48)49)22(12-36(56)57)28(44-26)15-29-24(6-10-34(52)53)42(2,17-38(60)61)31(45-29)16-30-25(7-11-35(54)55)43(3,18-39(62)63)41(19)47-30;/h14-16,24-25H,4-13,17-18H2,1-3H3,(H10,44,45,46,47,48,49,50,51,52,53,54,55,56,57,58,59,60,61,62,63);/q;+2/p-2/t24-,25-,42+,43+;/m1./s1 |
| InChIKey | RQHZZQLPDALGEQ-CYGMIEPJSA-L |
| Roles Classification |
|---|
| Biological Roles: | cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cobalt(II)-factor III (CHEBI:73373) is a cobalt corrinoid (CHEBI:33906) |
| cobalt(II)-factor III (CHEBI:73373) is a metalloporphyrin (CHEBI:25216) |
| cobalt(II)-factor III (CHEBI:73373) is conjugate acid of cobalt(II)-factor III(8−) (CHEBI:73299) |
| Incoming Relation(s) |
| cobalt(II)-factor III(8−) (CHEBI:73299) is conjugate base of cobalt(II)-factor III (CHEBI:73373) |
| IUPAC Name |
|---|
| {3,3',3'',3'''-[(7S,8S,12S,13S)-3,8,13,17-tetrakis(carboxymethyl)-8,13,15-trimethyl-7,8,12,13-tetrahydroporphyrin-2,7,12,18-tetrayl-κ4N21,N22,N23,N24]tetrapropanoato(2−)}cobalt |
| Synonym | Source |
|---|---|
| Cobalt-factor III | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C17401 | KEGG COMPOUND |
| Citations |
|---|