EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H33N5O7 |
| Net Charge | 0 |
| Average Mass | 431.490 |
| Monoisotopic Mass | 431.23800 |
| SMILES | CC(C)C[C@H](NC(=O)[C@H](C)N)C(=O)N[C@H](C(=O)N[C@@H](CCC(N)=O)C(=O)O)[C@@H](C)O |
| InChI | InChI=1S/C18H33N5O7/c1-8(2)7-12(22-15(26)9(3)19)16(27)23-14(10(4)24)17(28)21-11(18(29)30)5-6-13(20)25/h8-12,14,24H,5-7,19H2,1-4H3,(H2,20,25)(H,21,28)(H,22,26)(H,23,27)(H,29,30)/t9-,10+,11-,12-,14-/m0/s1 |
| InChIKey | MLNSNVLOEIYJIU-ZUDIRPEPSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ala-Leu-Thr-Gln (CHEBI:73372) has functional parent L-alanine (CHEBI:16977) |
| Ala-Leu-Thr-Gln (CHEBI:73372) has functional parent L-glutamine (CHEBI:18050) |
| Ala-Leu-Thr-Gln (CHEBI:73372) has functional parent L-leucine (CHEBI:15603) |
| Ala-Leu-Thr-Gln (CHEBI:73372) has functional parent L-threonine (CHEBI:16857) |
| Ala-Leu-Thr-Gln (CHEBI:73372) has role metabolite (CHEBI:25212) |
| Ala-Leu-Thr-Gln (CHEBI:73372) is a tetrapeptide (CHEBI:48030) |
| IUPAC Name |
|---|
| L-alanyl-L-leucyl-L-threonyl-L-glutamine |
| Synonyms | Source |
|---|---|
| ALTQ | ChEBI |
| A-L-T-Q | ChEBI |
| L-Ala-L-Leu-L-Thr-L-Gln | ChEBI |