EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:73370 - iodocyanopindolol
| Formula | C16H20IN3O2 |
| Net Charge | 0 |
| Average Mass | 413.259 |
| Monoisotopic Mass | 413.06002 |
| SMILES | CC(C)(C)NCC(O)COc1cccc2nc(C#N)c(I)c12 |
| InChI | InChI=1S/C16H20IN3O2/c1-16(2,3)19-8-10(21)9-22-13-6-4-5-11-14(13)15(17)12(7-18)20-11/h4-6,10,19-21H,8-9H2,1-3H3 |
| InChIKey | JBLUMBNIBNHRSO-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | beta-adrenergic antagonist An agent that binds to but does not activate β-adrenergic receptors thereby blocking the actions of endogenous or exogenous β-adrenergic agonists. β-Adrenergic antagonists are used for treatment of hypertension, cardiac arrhythmias, angina pectoris, glaucoma, migraine headaches and anxiety. serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. |
| Applications: | beta-adrenergic antagonist An agent that binds to but does not activate β-adrenergic receptors thereby blocking the actions of endogenous or exogenous β-adrenergic agonists. β-Adrenergic antagonists are used for treatment of hypertension, cardiac arrhythmias, angina pectoris, glaucoma, migraine headaches and anxiety. serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| iodocyanopindolol (CHEBI:73370) has role serotonergic antagonist (CHEBI:48279) |
| iodocyanopindolol (CHEBI:73370) has role β-adrenergic antagonist (CHEBI:35530) |
| iodocyanopindolol (CHEBI:73370) is a aromatic ether (CHEBI:35618) |
| iodocyanopindolol (CHEBI:73370) is a indoles (CHEBI:24828) |
| iodocyanopindolol (CHEBI:73370) is a nitrile (CHEBI:18379) |
| iodocyanopindolol (CHEBI:73370) is a organoiodine compound (CHEBI:37142) |
| iodocyanopindolol (CHEBI:73370) is a secondary alcohol (CHEBI:35681) |
| iodocyanopindolol (CHEBI:73370) is a secondary amino compound (CHEBI:50995) |
| IUPAC Name |
|---|
| 4-[3-(tert-butylamino)-2-hydroxypropoxy]-3-iodo-1-indole-2-carbonitrile |
| Synonym | Source |
|---|---|
| 4-(2-Hydroxy-3-(tert-butylamino)propoxy)-3-iodo-1H-indole-2-carbonitrile | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| Iodocyanopindolol | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8716017 | Reaxys |
| CAS:80180-26-3 | ChemIDplus |
| Citations |
|---|