EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:73370 - iodocyanopindolol
| Formula | C16H20IN3O2 |
| Net Charge | 0 |
| Average Mass | 413.259 |
| Monoisotopic Mass | 413.06002 |
| SMILES | CC(C)(C)NCC(O)COc1cccc2nc(C#N)c(I)c12 |
| InChI | InChI=1S/C16H20IN3O2/c1-16(2,3)19-8-10(21)9-22-13-6-4-5-11-14(13)15(17)12(7-18)20-11/h4-6,10,19-21H,8-9H2,1-3H3 |
| InChIKey | JBLUMBNIBNHRSO-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. beta-adrenergic antagonist An agent that binds to but does not activate β-adrenergic receptors thereby blocking the actions of endogenous or exogenous β-adrenergic agonists. β-Adrenergic antagonists are used for treatment of hypertension, cardiac arrhythmias, angina pectoris, glaucoma, migraine headaches and anxiety. |
| Applications: | serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. beta-adrenergic antagonist An agent that binds to but does not activate β-adrenergic receptors thereby blocking the actions of endogenous or exogenous β-adrenergic agonists. β-Adrenergic antagonists are used for treatment of hypertension, cardiac arrhythmias, angina pectoris, glaucoma, migraine headaches and anxiety. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| iodocyanopindolol (CHEBI:73370) has role serotonergic antagonist (CHEBI:48279) |
| iodocyanopindolol (CHEBI:73370) has role β-adrenergic antagonist (CHEBI:35530) |
| iodocyanopindolol (CHEBI:73370) is a aromatic ether (CHEBI:35618) |
| iodocyanopindolol (CHEBI:73370) is a indoles (CHEBI:24828) |
| iodocyanopindolol (CHEBI:73370) is a nitrile (CHEBI:18379) |
| iodocyanopindolol (CHEBI:73370) is a organoiodine compound (CHEBI:37142) |
| iodocyanopindolol (CHEBI:73370) is a secondary alcohol (CHEBI:35681) |
| iodocyanopindolol (CHEBI:73370) is a secondary amino compound (CHEBI:50995) |
| IUPAC Name |
|---|
| 4-[3-(tert-butylamino)-2-hydroxypropoxy]-3-iodo-1-indole-2-carbonitrile |
| Synonym | Source |
|---|---|
| 4-(2-Hydroxy-3-(tert-butylamino)propoxy)-3-iodo-1H-indole-2-carbonitrile | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| Iodocyanopindolol | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8716017 | Reaxys |
| CAS:80180-26-3 | ChemIDplus |
| Citations |
|---|