EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H36N4O6 |
| Net Charge | 0 |
| Average Mass | 416.519 |
| Monoisotopic Mass | 416.26348 |
| SMILES | CC(C)C[C@H](NC(=O)[C@H](C)N)C(=O)N[C@@H](CC(C)C)C(=O)N[C@H](C(=O)O)[C@@H](C)O |
| InChI | InChI=1S/C19H36N4O6/c1-9(2)7-13(21-16(25)11(5)20)17(26)22-14(8-10(3)4)18(27)23-15(12(6)24)19(28)29/h9-15,24H,7-8,20H2,1-6H3,(H,21,25)(H,22,26)(H,23,27)(H,28,29)/t11-,12+,13-,14-,15-/m0/s1 |
| InChIKey | QPBSRMDNJOTFAL-AICCOOGYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ala-Leu-Leu-Thr (CHEBI:73368) has functional parent L-alanine (CHEBI:16977) |
| Ala-Leu-Leu-Thr (CHEBI:73368) has functional parent L-leucine (CHEBI:15603) |
| Ala-Leu-Leu-Thr (CHEBI:73368) has functional parent L-threonine (CHEBI:16857) |
| Ala-Leu-Leu-Thr (CHEBI:73368) has role metabolite (CHEBI:25212) |
| Ala-Leu-Leu-Thr (CHEBI:73368) is a tetrapeptide (CHEBI:48030) |
| IUPAC Name |
|---|
| L-alanyl-L-leucyl-L-leucyl-L-threonine |
| Synonyms | Source |
|---|---|
| A-L-L-T | ChEBI |
| ALLT | ChEBI |
| L-Ala-L-Leu-L-Leu-L-Thr | ChEBI |