EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H34N4O6 |
| Net Charge | 0 |
| Average Mass | 402.492 |
| Monoisotopic Mass | 402.24783 |
| SMILES | CC(C)C[C@H](NC(=O)[C@H](C)N)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CO)C(=O)O |
| InChI | InChI=1S/C18H34N4O6/c1-9(2)6-12(20-15(24)11(5)19)16(25)21-13(7-10(3)4)17(26)22-14(8-23)18(27)28/h9-14,23H,6-8,19H2,1-5H3,(H,20,24)(H,21,25)(H,22,26)(H,27,28)/t11-,12-,13-,14-/m0/s1 |
| InChIKey | ZKEHTYWGPMMGBC-XUXIUFHCSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ala-Leu-Leu-Ser (CHEBI:73366) has functional parent L-alanine (CHEBI:16977) |
| Ala-Leu-Leu-Ser (CHEBI:73366) has functional parent L-leucine (CHEBI:15603) |
| Ala-Leu-Leu-Ser (CHEBI:73366) has functional parent L-serine (CHEBI:17115) |
| Ala-Leu-Leu-Ser (CHEBI:73366) has role metabolite (CHEBI:25212) |
| Ala-Leu-Leu-Ser (CHEBI:73366) is a tetrapeptide (CHEBI:48030) |
| IUPAC Name |
|---|
| L-alanyl-L-leucyl-L-leucyl-L-serine |
| Synonyms | Source |
|---|---|
| ALLS | ChEBI |
| L-Ala-L-Leu-L-Leu-L-Ser | ChEBI |
| A-L-L-S | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8516875 | Reaxys |