EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H25NO |
| Net Charge | 0 |
| Average Mass | 247.382 |
| Monoisotopic Mass | 247.19361 |
| SMILES | CCCN(CCC)C1CCc2cccc(O)c2C1 |
| InChI | InChI=1S/C16H25NO/c1-3-10-17(11-4-2)14-9-8-13-6-5-7-16(18)15(13)12-14/h5-7,14,18H,3-4,8-12H2,1-2H3 |
| InChIKey | ASXGJMSKWNBENU-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. |
| Application: | serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 8-OH-DPAT (CHEBI:73364) has parent hydride tetralin (CHEBI:35008) |
| 8-OH-DPAT (CHEBI:73364) has role serotonergic antagonist (CHEBI:48279) |
| 8-OH-DPAT (CHEBI:73364) is a phenols (CHEBI:33853) |
| 8-OH-DPAT (CHEBI:73364) is a tertiary amino compound (CHEBI:50996) |
| 8-OH-DPAT (CHEBI:73364) is a tetralins (CHEBI:36786) |
| IUPAC Name |
|---|
| 7-(dipropylamino)-5,6,7,8-tetrahydronaphthalen-1-ol |
| Synonym | Source |
|---|---|
| 8-Hydroxy-2-(di-n-propylamino)tetralin | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3546291 | Reaxys |
| CAS:78950-78-4 | ChemIDplus |
| Citations |
|---|