EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H34N4O7 |
| Net Charge | 0 |
| Average Mass | 430.502 |
| Monoisotopic Mass | 430.24275 |
| SMILES | CC(C)C[C@H](NC(=O)[C@H](C)N)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(=O)O)C(=O)O |
| InChI | InChI=1S/C19H34N4O7/c1-9(2)6-12(21-16(26)11(5)20)17(27)22-13(7-10(3)4)18(28)23-14(19(29)30)8-15(24)25/h9-14H,6-8,20H2,1-5H3,(H,21,26)(H,22,27)(H,23,28)(H,24,25)(H,29,30)/t11-,12-,13-,14-/m0/s1 |
| InChIKey | VGMNWQOPSFBBBG-XUXIUFHCSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ala-Leu-Leu-Asp (CHEBI:73363) has functional parent L-alanine (CHEBI:16977) |
| Ala-Leu-Leu-Asp (CHEBI:73363) has functional parent L-aspartic acid (CHEBI:17053) |
| Ala-Leu-Leu-Asp (CHEBI:73363) has functional parent L-leucine (CHEBI:15603) |
| Ala-Leu-Leu-Asp (CHEBI:73363) has role metabolite (CHEBI:25212) |
| Ala-Leu-Leu-Asp (CHEBI:73363) is a tetrapeptide (CHEBI:48030) |
| IUPAC Name |
|---|
| L-alanyl-L-leucyl-L-leucyl-L-aspartic acid |
| Synonyms | Source |
|---|---|
| ALLD | ChEBI |
| A-L-L-D | ChEBI |
| L-Ala-L-Leu-L-Leu-L-Asp | ChEBI |