EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H32N2O2 |
| Net Charge | 0 |
| Average Mass | 356.510 |
| Monoisotopic Mass | 356.24638 |
| SMILES | CN(C(=O)Cc1ccccc1)[C@H]1CC[C@@]2(CCCO2)C[C@@H]1N1CCCC1 |
| InChI | InChI=1S/C22H32N2O2/c1-23(21(25)16-18-8-3-2-4-9-18)19-10-12-22(11-7-15-26-22)17-20(19)24-13-5-6-14-24/h2-4,8-9,19-20H,5-7,10-17H2,1H3/t19-,20-,22-/m0/s1 |
| InChIKey | PGZRDDYTKFZSFR-ONTIZHBOSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | kappa-opioid receptor agonist A compound that exhibits agonist activity at the κ-opioid receptor. |
| Applications: | diuretic An agent that promotes the excretion of urine through its effects on kidney function. anti-inflammatory agent Any compound that has anti-inflammatory effects. kappa-opioid receptor agonist A compound that exhibits agonist activity at the κ-opioid receptor. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| U69593 (CHEBI:73357) has role anti-inflammatory agent (CHEBI:67079) |
| U69593 (CHEBI:73357) has role diuretic (CHEBI:35498) |
| U69593 (CHEBI:73357) has role κ-opioid receptor agonist (CHEBI:59282) |
| U69593 (CHEBI:73357) is a N-alkylpyrrolidine (CHEBI:46775) |
| U69593 (CHEBI:73357) is a monocarboxylic acid amide (CHEBI:29347) |
| U69593 (CHEBI:73357) is a organic heterobicyclic compound (CHEBI:27171) |
| U69593 (CHEBI:73357) is a oxaspiro compound (CHEBI:37948) |
| IUPAC Name |
|---|
| N-methyl-2-phenyl-N-[(5R,7S,8S)-7-(pyrrolidin-1-yl)-1-oxaspiro[4.5]dec-8-yl]acetamide |
| Synonyms | Source |
|---|---|
| U 69593 | ChemIDplus |
| (5α,7α,8β)-(−)-N-methyl-N-(7-(1-pyrrolidinyl)-1-oxaspiro(4.5)dec-8-yl)-benzeneacetamide | ChemIDplus |
| U-69593 | ChemIDplus |
| U 69,593 | ChemIDplus |
| N-methyl-N-((5R,7S,8S)-7-(1-pyrrolidinyl)-1-oxaspiro(4.5)dec-8-yl)-benzeneacetamide | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| U-69,593 | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7488908 | Reaxys |
| CAS:96744-75-1 | ChemIDplus |
| Citations |
|---|