EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H39N5O7S2 |
| Net Charge | 0 |
| Average Mass | 645.804 |
| Monoisotopic Mass | 645.22909 |
| SMILES | CC1(C)SSC(C)(C)[C@@H](NC(=O)[C@@H](N)Cc2ccc(O)cc2)C(=O)NCC(=O)N[C@@H](Cc2ccccc2)C(=O)N[C@H]1C(=O)O |
| InChI | InChI=1S/C30H39N5O7S2/c1-29(2)23(34-25(38)20(31)14-18-10-12-19(36)13-11-18)27(40)32-16-22(37)33-21(15-17-8-6-5-7-9-17)26(39)35-24(28(41)42)30(3,4)44-43-29/h5-13,20-21,23-24,36H,14-16,31H2,1-4H3,(H,32,40)(H,33,37)(H,34,38)(H,35,39)(H,41,42)/t20-,21-,23-,24-/m0/s1 |
| InChIKey | MCMMCRYPQBNCPH-WMIMKTLMSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | delta-opioid receptor agonist A compound that exhibits agonist activity at the δ-opioid receptor. |
| Application: | delta-opioid receptor agonist A compound that exhibits agonist activity at the δ-opioid receptor. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| DPDPE (CHEBI:73356) has role δ-opioid receptor agonist (CHEBI:64054) |
| DPDPE (CHEBI:73356) is a heterodetic cyclic peptide (CHEBI:24533) |
| IUPAC Name |
|---|
| (4S,7S,13S)-7-benzyl-3,3,14,14-tetramethyl-6,9,12-trioxo-13-(L-tyrosylamino)-1,2-dithia-5,8,11-triazacyclotetradecane-4-carboxylic acid |
| Synonyms | Source |
|---|---|
| D-penicillamine-(2,5)-enkephalin | ChEBI |
| 2,5-Pen-enkephalin | KEGG COMPOUND |
| L-tyrosyl-3-mercapto-D-valylglycyl-L-phenylalanyl-3-mercapto-D-valine, cyclic (2-5)-disulfide | ChemIDplus |
| (D-Pen2,D-Pen5)-Enkephalin | ChemIDplus |
| H-Tyr-cyclo-(D-Pen-Gly-Phe-D-Pen)-OH | ChEBI |
| cyclo-[D-Pen2,5]-enkephalin | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C20164 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3586429 | Reaxys |
| CAS:88373-73-3 | ChemIDplus |
| Citations |
|---|