EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H28N4O9 |
| Net Charge | 0 |
| Average Mass | 432.430 |
| Monoisotopic Mass | 432.18563 |
| SMILES | CC(C)C[C@H](NC(=O)[C@H](C)N)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](CC(=O)O)C(=O)O |
| InChI | InChI=1S/C17H28N4O9/c1-7(2)4-9(19-14(26)8(3)18)15(27)20-10(5-12(22)23)16(28)21-11(17(29)30)6-13(24)25/h7-11H,4-6,18H2,1-3H3,(H,19,26)(H,20,27)(H,21,28)(H,22,23)(H,24,25)(H,29,30)/t8-,9-,10-,11-/m0/s1 |
| InChIKey | GHBSKQGCIYSCNS-NAKRPEOUSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ala-Leu-Asp-Asp (CHEBI:73355) has functional parent L-alanine (CHEBI:16977) |
| Ala-Leu-Asp-Asp (CHEBI:73355) has functional parent L-aspartic acid (CHEBI:17053) |
| Ala-Leu-Asp-Asp (CHEBI:73355) has functional parent L-leucine (CHEBI:15603) |
| Ala-Leu-Asp-Asp (CHEBI:73355) has role metabolite (CHEBI:25212) |
| Ala-Leu-Asp-Asp (CHEBI:73355) is a tetrapeptide (CHEBI:48030) |
| IUPAC Name |
|---|
| L-alanyl-L-leucyl-L-α-aspartyl-L-aspartic acid |
| Synonyms | Source |
|---|---|
| L-Ala-L-Leu-L-Asp-L-Asp | ChEBI |
| ALDD | ChEBI |
| A-L-D-D | ChEBI |