EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H22N4O5 |
| Net Charge | 0 |
| Average Mass | 314.342 |
| Monoisotopic Mass | 314.15902 |
| SMILES | C[C@H](N)C(=O)N[C@@H](CCC(N)=O)C(=O)N1CCC[C@H]1C(=O)O |
| InChI | InChI=1S/C13H22N4O5/c1-7(14)11(19)16-8(4-5-10(15)18)12(20)17-6-2-3-9(17)13(21)22/h7-9H,2-6,14H2,1H3,(H2,15,18)(H,16,19)(H,21,22)/t7-,8-,9-/m0/s1 |
| InChIKey | CZPAHAKGPDUIPJ-CIUDSAMLSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ala-Gln-Pro (CHEBI:73347) has functional parent L-alanine (CHEBI:16977) |
| Ala-Gln-Pro (CHEBI:73347) has functional parent L-glutamine (CHEBI:18050) |
| Ala-Gln-Pro (CHEBI:73347) has functional parent L-proline (CHEBI:17203) |
| Ala-Gln-Pro (CHEBI:73347) has role metabolite (CHEBI:25212) |
| Ala-Gln-Pro (CHEBI:73347) is a tripeptide (CHEBI:47923) |
| IUPAC Name |
|---|
| L-alanyl-L-glutaminyl-L-proline |
| Synonyms | Source |
|---|---|
| AQP | ChEBI |
| L-Ala-L-Gln-L-Pro | ChEBI |
| A-Q-P | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4822490 | Reaxys |