EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H17N3O7 |
| Net Charge | 0 |
| Average Mass | 291.260 |
| Monoisotopic Mass | 291.10665 |
| SMILES | C[C@H](N)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](CO)C(=O)O |
| InChI | InChI=1S/C10H17N3O7/c1-4(11)8(17)12-5(2-7(15)16)9(18)13-6(3-14)10(19)20/h4-6,14H,2-3,11H2,1H3,(H,12,17)(H,13,18)(H,15,16)(H,19,20)/t4-,5-,6-/m0/s1 |
| InChIKey | BUDNAJYVCUHLSV-ZLUOBGJFSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ala-Asp-Ser (CHEBI:73344) has functional parent L-alanine (CHEBI:16977) |
| Ala-Asp-Ser (CHEBI:73344) has functional parent L-aspartic acid (CHEBI:17053) |
| Ala-Asp-Ser (CHEBI:73344) has functional parent L-serine (CHEBI:17115) |
| Ala-Asp-Ser (CHEBI:73344) has role metabolite (CHEBI:25212) |
| Ala-Asp-Ser (CHEBI:73344) is a tripeptide (CHEBI:47923) |
| IUPAC Name |
|---|
| L-alanyl-L-α-aspartyl-L-serine |
| Synonyms | Source |
|---|---|
| A-D-S | ChEBI |
| L-Ala-L-Asp-L-Ser | ChEBI |
| ADS | ChEBI |