EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C36H62N4O2 |
| Net Charge | 0 |
| Average Mass | 582.918 |
| Monoisotopic Mass | 582.48728 |
| SMILES | COc1ccccc1CNCCCCCCNCCCCCCCCNCCCCCCNCc1ccccc1OC |
| InChI | InChI=1S/C36H62N4O2/c1-41-35-23-13-11-21-33(35)31-39-29-19-9-7-17-27-37-25-15-5-3-4-6-16-26-38-28-18-8-10-20-30-40-32-34-22-12-14-24-36(34)42-2/h11-14,21-24,37-40H,3-10,15-20,25-32H2,1-2H3 |
| InChIKey | RPMBYDYUVKEZJA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. |
| Application: | muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methoctramine (CHEBI:73339) has role muscarinic antagonist (CHEBI:48876) |
| methoctramine (CHEBI:73339) is a aromatic ether (CHEBI:35618) |
| methoctramine (CHEBI:73339) is a tetramine (CHEBI:39166) |
| methoctramine (CHEBI:73339) is conjugate base of methoctramine(4+) (CHEBI:73453) |
| Incoming Relation(s) |
| methoctramine(4+) (CHEBI:73453) is conjugate acid of methoctramine (CHEBI:73339) |
| IUPAC Name |
|---|
| N,N'-bis{6-[(2-methoxybenzyl)amino]hexyl}octane-1,8-diamine |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4772600 | Reaxys |
| Citations |
|---|