EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H38N6O2 |
| Net Charge | 0 |
| Average Mass | 478.641 |
| Monoisotopic Mass | 478.30562 |
| SMILES | CCCN(CCC)C[C@H]1CCCCN1CCNC(=O)N1c2ccccc2C(=O)Nc2cccnc21 |
| InChI | InChI=1S/C27H38N6O2/c1-3-16-31(17-4-2)20-21-10-7-8-18-32(21)19-15-29-27(35)33-24-13-6-5-11-22(24)26(34)30-23-12-9-14-28-25(23)33/h5-6,9,11-14,21H,3-4,7-8,10,15-20H2,1-2H3,(H,29,35)(H,30,34)/t21-/m1/s1 |
| InChIKey | MZDYABXXPZNUCT-OAQYLSRUSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. |
| Application: | muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| AF-DX 384 (CHEBI:73338) has role muscarinic antagonist (CHEBI:48876) |
| AF-DX 384 (CHEBI:73338) is a piperidines (CHEBI:26151) |
| AF-DX 384 (CHEBI:73338) is a pyridobenzodiazepine (CHEBI:71329) |
| AF-DX 384 (CHEBI:73338) is a tertiary amino compound (CHEBI:50996) |
| AF-DX 384 (CHEBI:73338) is a ureas (CHEBI:47857) |
| IUPAC Name |
|---|
| N-(2-{(2H)-2-[(dipropylamino)methyl]piperidin-1-yl}ethyl)-6-oxo-5,6-dihydro-11H-pyrido[2,3-b][1,4]benzodiazepine-11-carboxamide |
| Synonyms | Source |
|---|---|
| BIBN-161 | ChEBI |
| AFDX-384 | ChEBI |
| (R)-(−)-AF-DX 384 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| AFDX-384 | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8523014 | Reaxys |
| Citations |
|---|