EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H11N3 |
| Net Charge | 0 |
| Average Mass | 125.175 |
| Monoisotopic Mass | 125.09530 |
| SMILES | C[C@@H](N)Cc1cncn1 |
| InChI | InChI=1S/C6H11N3/c1-5(7)2-6-3-8-4-9-6/h3-5H,2,7H2,1H3,(H,8,9)/t5-/m1/s1 |
| InChIKey | XNQIOISZPFVUFG-RXMQYKEDSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | H3-receptor agonist A histamine agonist that binds to and activates histamine H3-receptors. |
| Application: | H3-receptor agonist A histamine agonist that binds to and activates histamine H3-receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-α-methylhistamine (CHEBI:73337) has role H3-receptor agonist (CHEBI:64154) |
| (R)-α-methylhistamine (CHEBI:73337) is a aralkylamino compound (CHEBI:64365) |
| (R)-α-methylhistamine (CHEBI:73337) is a imidazoles (CHEBI:24780) |
| IUPAC Name |
|---|
| (2R)-1-(1H-imidazol-4-yl)propan-2-amine |
| Synonyms | Source |
|---|---|
| (R)-(−)-4-(2-aminopropyl)imidazole | ChEBI |
| (R)α-Me-histamine | ChEBI |
| (R)-(−)-α-methylhistamine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| EP214058 | Patent |
| US2002151576 | Patent |
| US2003113309 | Patent |
| US2005245587 | Patent |
| US4767778 | Patent |
| US5773457 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6053636 | Reaxys |
| CAS:75614-87-8 | ChemIDplus |
| Citations |
|---|