EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H26N6O8 |
| Net Charge | 0 |
| Average Mass | 418.407 |
| Monoisotopic Mass | 418.18121 |
| SMILES | C[C@H](N)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CO)C(=O)O |
| InChI | InChI=1S/C15H26N6O8/c1-6(16)12(25)20-8(4-11(18)24)14(27)19-7(2-3-10(17)23)13(26)21-9(5-22)15(28)29/h6-9,22H,2-5,16H2,1H3,(H2,17,23)(H2,18,24)(H,19,27)(H,20,25)(H,21,26)(H,28,29)/t6-,7-,8-,9-/m0/s1 |
| InChIKey | MCGGOMKMWPPXKQ-JBDRJPRFSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ala-Asn-Gln-Ser (CHEBI:73331) has functional parent L-alanine (CHEBI:16977) |
| Ala-Asn-Gln-Ser (CHEBI:73331) has functional parent L-asparagine (CHEBI:17196) |
| Ala-Asn-Gln-Ser (CHEBI:73331) has functional parent L-glutamine (CHEBI:18050) |
| Ala-Asn-Gln-Ser (CHEBI:73331) has functional parent L-serine (CHEBI:17115) |
| Ala-Asn-Gln-Ser (CHEBI:73331) has role metabolite (CHEBI:25212) |
| Ala-Asn-Gln-Ser (CHEBI:73331) is a tetrapeptide (CHEBI:48030) |
| IUPAC Name |
|---|
| L-alanyl-L-asparaginyl-L-glutaminyl-L-serine |
| Synonyms | Source |
|---|---|
| A-N-Q-S | ChEBI |
| L-Ala-L-Asn-L-Gln-L-Ser | ChEBI |
| ANQS | ChEBI |