EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H13N3O4 |
| Net Charge | 0 |
| Average Mass | 203.198 |
| Monoisotopic Mass | 203.09061 |
| SMILES | C[C@H](N)C(=O)N[C@@H](CC(N)=O)C(=O)O |
| InChI | InChI=1S/C7H13N3O4/c1-3(8)6(12)10-4(7(13)14)2-5(9)11/h3-4H,2,8H2,1H3,(H2,9,11)(H,10,12)(H,13,14)/t3-,4-/m0/s1 |
| InChIKey | CCUAQNUWXLYFRA-IMJSIDKUSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ala-Asn (CHEBI:73330) has functional parent L-alanine (CHEBI:16977) |
| Ala-Asn (CHEBI:73330) has functional parent L-asparagine (CHEBI:17196) |
| Ala-Asn (CHEBI:73330) has role metabolite (CHEBI:25212) |
| Ala-Asn (CHEBI:73330) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| L-alanyl-L-asparagine |
| Synonyms | Source |
|---|---|
| A-N | ChEBI |
| AN | ChEBI |
| L-Ala-L-Asn | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5335044 | Reaxys |