EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H26N4O5 |
| Net Charge | 0 |
| Average Mass | 354.407 |
| Monoisotopic Mass | 354.19032 |
| SMILES | C[C@H](N)C(=O)N[C@@H](C)C(=O)N1CCC[C@H]1C(=O)N1CCC[C@H]1C(=O)O |
| InChI | InChI=1S/C16H26N4O5/c1-9(17)13(21)18-10(2)14(22)19-7-3-5-11(19)15(23)20-8-4-6-12(20)16(24)25/h9-12H,3-8,17H2,1-2H3,(H,18,21)(H,24,25)/t9-,10-,11-,12-/m0/s1 |
| InChIKey | ZFXQNADNEBRERM-BJDJZHNGSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ala-Ala-Pro-Pro (CHEBI:73324) has functional parent L-alanine (CHEBI:16977) |
| Ala-Ala-Pro-Pro (CHEBI:73324) has functional parent L-proline (CHEBI:17203) |
| Ala-Ala-Pro-Pro (CHEBI:73324) has role metabolite (CHEBI:25212) |
| Ala-Ala-Pro-Pro (CHEBI:73324) is a tetrapeptide (CHEBI:48030) |
| IUPAC Name |
|---|
| L-alanyl-L-alanyl-L-prolyl-L-proline |
| Synonyms | Source |
|---|---|
| A-A-P-P | ChEBI |
| AAPP | ChEBI |
| L-Ala-L-Ala-L-Pro-L-Pro | ChEBI |