EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H17N3O6 |
| Net Charge | 0 |
| Average Mass | 275.261 |
| Monoisotopic Mass | 275.11174 |
| SMILES | C[C@H](N)C(=O)N[C@@H](C)C(=O)N[C@@H](CC(=O)O)C(=O)O |
| InChI | InChI=1S/C10H17N3O6/c1-4(11)8(16)12-5(2)9(17)13-6(10(18)19)3-7(14)15/h4-6H,3,11H2,1-2H3,(H,12,16)(H,13,17)(H,14,15)(H,18,19)/t4-,5-,6-/m0/s1 |
| InChIKey | DKJPOZOEBONHFS-ZLUOBGJFSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ala-Ala-Asp (CHEBI:73317) has functional parent L-alanine (CHEBI:16977) |
| Ala-Ala-Asp (CHEBI:73317) has functional parent L-aspartic acid (CHEBI:17053) |
| Ala-Ala-Asp (CHEBI:73317) has role metabolite (CHEBI:25212) |
| Ala-Ala-Asp (CHEBI:73317) is a tripeptide (CHEBI:47923) |
| IUPAC Name |
|---|
| L-alanyl-L-alanyl-L-aspartic acid |
| Synonyms | Source |
|---|---|
| A-A-D | ChEBI |
| AAD | ChEBI |
| L-Ala-L-Ala-L-Asp | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:14710534 | Reaxys |